Sakuranetin
Catalog No: FT-0650767
CAS No: 2957-21-3
- Chemical Name: Sakuranetin
- Molecular Formula: C16H14O5
- Molecular Weight: 286.28
- InChI Key: DJOJDHGQRNZXQQ-AWEZNQCLSA-N
- InChI: InChI=1S/C16H14O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-7,14,17-18H,8H2,1H3/t14-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 555.9±50.0 °C at 760 mmHg |
|---|---|
| Symbol: | GHS07 |
| MF: | C16H14O5 |
| Melting_Point: | 153-154ºC |
| Flash_Point: | 212.4±23.6 °C |
| FW: | 286.279 |
| Product_Name: | (-)-(S)-Sakuranetin |
| CAS: | 2957-21-3 |
| Density: | 1.4±0.1 g/cm3 |
| PSA: | 75.99000 |
|---|---|
| Refractive_Index: | 1.638 |
| Flash_Point: | 212.4±23.6 °C |
| FW: | 286.279 |
| LogP: | 3.37 |
| Exact_Mass: | 286.084137 |
| Bolling_Point: | 555.9±50.0 °C at 760 mmHg |
| MF: | C16H14O5 |
| Melting_Point: | 153-154ºC |
| Vapor_Pressure: | 0.0±1.6 mmHg at 25°C |
| Density: | 1.4±0.1 g/cm3 |
| Safety_Statements: | H302 |
|---|---|
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)